C15H22ClN3O5 — CID 120839066
methyl 2-[4-[[(2S)-2-methylpiperazin-1-yl]methyl]-2-nitrophenoxy]acetate;hydrochloride (PubChem CID 120839066) has the molecular formula C15H22ClN3O5 and a molecular weight of 359.81 g/mol. Its IUPAC name is methyl 2-[4-[[(2S)-2-methylpiperazin-1-yl]methyl]-2-nitrophenoxy]acetate;hydrochloride.
| Compound Name | methyl 2-[4-[[(2S)-2-methylpiperazin-1-yl]methyl]-2-nitrophenoxy]acetate;hydrochloride |
|---|---|
| PubChem CID | 120839066 |
| Molecular Formula | C15H22ClN3O5 |
| Molecular Weight | 359.81 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | methyl 2-[4-[[(2S)-2-methylpiperazin-1-yl]methyl]-2-nitrophenoxy]acetate;hydrochloride |
| SMILES | COC(=O)COc1ccc(CN2CCNC[C@@H]2C)cc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C15H21N3O5.ClH/c1-11-8-16-5-6-17(11)9-12-3-4-14(13(7-12)18(20)21)23-10-15(19)22-2;/h3-4,7,11,16H,5-6,8-10H2,1-2H3;1H/t11-;/m0./s1 |
| InChIKey | MFDMBXYNCJCBEL-MERQFXBCSA-N |
| XLogP | 1.36 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.81 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|