C15H21N3O5 — CID 120845540
methyl 2-[4-[[(3R)-3-methylpiperazin-1-yl]methyl]-2-nitrophenoxy]acetate (PubChem CID 120845540) has the molecular formula C15H21N3O5 and a molecular weight of 323.35 g/mol. Its IUPAC name is methyl 2-[4-[[(3R)-3-methylpiperazin-1-yl]methyl]-2-nitrophenoxy]acetate.
| Compound Name | methyl 2-[4-[[(3R)-3-methylpiperazin-1-yl]methyl]-2-nitrophenoxy]acetate |
|---|---|
| PubChem CID | 120845540 |
| Molecular Formula | C15H21N3O5 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | methyl 2-[4-[[(3R)-3-methylpiperazin-1-yl]methyl]-2-nitrophenoxy]acetate |
| SMILES | COC(=O)COc1ccc(CN2CCN[C@H](C)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H21N3O5/c1-11-8-17(6-5-16-11)9-12-3-4-14(13(7-12)18(20)21)23-10-15(19)22-2/h3-4,7,11,16H,5-6,8-10H2,1-2H3/t11-/m1/s1 |
| InChIKey | RNOONXXHSZHNJG-LLVKDONJSA-N |
| XLogP | 0.94 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|