C18H26N4O6 — CID 120837252
methyl 2-[4-[[3-(2-aminoethylcarbamoyl)piperidin-1-yl]methyl]-2-nitrophenoxy]acetate (PubChem CID 120837252) has the molecular formula C18H26N4O6 and a molecular weight of 394.43 g/mol. Its IUPAC name is methyl 2-[4-[[3-(2-aminoethylcarbamoyl)piperidin-1-yl]methyl]-2-nitrophenoxy]acetate.
| Compound Name | methyl 2-[4-[[3-(2-aminoethylcarbamoyl)piperidin-1-yl]methyl]-2-nitrophenoxy]acetate |
|---|---|
| PubChem CID | 120837252 |
| Molecular Formula | C18H26N4O6 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | methyl 2-[4-[[3-(2-aminoethylcarbamoyl)piperidin-1-yl]methyl]-2-nitrophenoxy]acetate |
| SMILES | COC(=O)COc1ccc(CN2CCCC(C(=O)NCCN)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H26N4O6/c1-27-17(23)12-28-16-5-4-13(9-15(16)22(25)26)10-21-8-2-3-14(11-21)18(24)20-7-6-19/h4-5,9,14H,2-3,6-8,10-12,19H2,1H3,(H,20,24) |
| InChIKey | CBOYIQIRLOWHRW-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 137.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|