C14H6N5O6+ — CID 6332668
(5,7-dinitro-9-oxofluorene-1-carbonyl)imino-iminoazanium (PubChem CID 6332668) has the molecular formula C14H6N5O6+ and a molecular weight of 340.23 g/mol. Its IUPAC name is (5,7-dinitro-9-oxofluorene-1-carbonyl)imino-iminoazanium.
| Compound Name | (5,7-dinitro-9-oxofluorene-1-carbonyl)imino-iminoazanium |
|---|---|
| PubChem CID | 6332668 |
| Molecular Formula | C14H6N5O6+ |
| Molecular Weight | 340.23 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | (5,7-dinitro-9-oxofluorene-1-carbonyl)imino-iminoazanium |
| SMILES | N=[N+]=NC(=O)c1cccc2c1C(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1-2 |
| InChI | InChI=1S/C14H6N5O6/c15-17-16-14(21)8-3-1-2-7-11-9(13(20)12(7)8)4-6(18(22)23)5-10(11)19(24)25/h1-5,15H/q+1 |
| InChIKey | FGFGFYLMPMQMQT-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 170.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.23 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|