C19H8F9N3O7 — CID 6836867
2,2,3,3,4,4,5,5,5-nonafluoropentyl 9-hydroxyimino-2,7-dinitrofluorene-4-carboxylate (PubChem CID 6836867) has the molecular formula C19H8F9N3O7 and a molecular weight of 561.27 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,5-nonafluoropentyl 9-hydroxyimino-2,7-dinitrofluorene-4-carboxylate.
| Compound Name | 2,2,3,3,4,4,5,5,5-nonafluoropentyl 9-hydroxyimino-2,7-dinitrofluorene-4-carboxylate |
|---|---|
| PubChem CID | 6836867 |
| Molecular Formula | C19H8F9N3O7 |
| Molecular Weight | 561.27 g/mol |
| Exact Mass | 561.02 |
| IUPAC Name | 2,2,3,3,4,4,5,5,5-nonafluoropentyl 9-hydroxyimino-2,7-dinitrofluorene-4-carboxylate |
| SMILES | O=C(OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1cc([N+](=O)[O-])cc2c1-c1ccc([N+](=O)[O-])cc1C2=NO |
| InChI | InChI=1S/C19H8F9N3O7/c20-16(21,17(22,23)18(24,25)19(26,27)28)6-38-15(32)12-5-8(31(36)37)4-11-13(12)9-2-1-7(30(34)35)3-10(9)14(11)29-33/h1-5,33H,6H2 |
| InChIKey | VWIJQSMJFIANJG-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 145.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.27 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|