C20H9Cl2N3O6 — CID 2817538
N-(2,4-dichlorophenyl)-2,7-dinitro-9-oxofluorene-4-carboxamide (PubChem CID 2817538) has the molecular formula C20H9Cl2N3O6 and a molecular weight of 458.21 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2,7-dinitro-9-oxofluorene-4-carboxamide.
| Compound Name | N-(2,4-dichlorophenyl)-2,7-dinitro-9-oxofluorene-4-carboxamide |
|---|---|
| PubChem CID | 2817538 |
| Molecular Formula | C20H9Cl2N3O6 |
| Molecular Weight | 458.21 g/mol |
| Exact Mass | 456.99 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2,7-dinitro-9-oxofluorene-4-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1Cl)c1cc([N+](=O)[O-])cc2c1-c1ccc([N+](=O)[O-])cc1C2=O |
| InChI | InChI=1S/C20H9Cl2N3O6/c21-9-1-4-17(16(22)5-9)23-20(27)15-8-11(25(30)31)7-14-18(15)12-3-2-10(24(28)29)6-13(12)19(14)26/h1-8H,(H,23,27) |
| InChIKey | MBCQEKVKDAUAGP-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 132.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.21 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|