C16H15Cl2N3O4 — CID 11440508
5-chloro-N-(2-chloro-4-nitrophenyl)-3-[(dimethylamino)methyl]-2-hydroxybenzamide (PubChem CID 11440508) has the molecular formula C16H15Cl2N3O4 and a molecular weight of 384.22 g/mol. Its IUPAC name is 5-chloro-N-(2-chloro-4-nitrophenyl)-3-[(dimethylamino)methyl]-2-hydroxybenzamide.
| Compound Name | 5-chloro-N-(2-chloro-4-nitrophenyl)-3-[(dimethylamino)methyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 11440508 |
| Molecular Formula | C16H15Cl2N3O4 |
| Molecular Weight | 384.22 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | 5-chloro-N-(2-chloro-4-nitrophenyl)-3-[(dimethylamino)methyl]-2-hydroxybenzamide |
| SMILES | CN(C)Cc1cc(Cl)cc(C(=O)Nc2ccc([N+](=O)[O-])cc2Cl)c1O |
| InChI | InChI=1S/C16H15Cl2N3O4/c1-20(2)8-9-5-10(17)6-12(15(9)22)16(23)19-14-4-3-11(21(24)25)7-13(14)18/h3-7,22H,8H2,1-2H3,(H,19,23) |
| InChIKey | DAUGLKWXGVTXJO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.22 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|