C39H29Cl2N2O4P — CID 11169937
5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxy-3-[2-phenyl-2-(triphenyl-λ5-phosphanylidene)ethyl]benzamide (PubChem CID 11169937) has the molecular formula C39H29Cl2N2O4P and a molecular weight of 691.55 g/mol. Its IUPAC name is 5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxy-3-[2-phenyl-2-(triphenyl-λ5-phosphanylidene)ethyl]benzamide.
| Compound Name | 5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxy-3-[2-phenyl-2-(triphenyl-λ5-phosphanylidene)ethyl]benzamide |
|---|---|
| PubChem CID | 11169937 |
| Molecular Formula | C39H29Cl2N2O4P |
| Molecular Weight | 691.55 g/mol |
| Exact Mass | 690.12 |
| IUPAC Name | 5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxy-3-[2-phenyl-2-(triphenyl-λ5-phosphanylidene)ethyl]benzamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1Cl)c1cc(Cl)cc(CC(c2ccccc2)=P(c2ccccc2)(c2ccccc2)c2ccccc2)c1O |
| InChI | InChI=1S/C39H29Cl2N2O4P/c40-29-23-28(38(44)34(25-29)39(45)42-36-22-21-30(43(46)47)26-35(36)41)24-37(27-13-5-1-6-14-27)48(31-15-7-2-8-16-31,32-17-9-3-10-18-32)33-19-11-4-12-20-33/h1-23,25-26,44H,24H2,(H,42,45) |
| InChIKey | ARLLOMRFGRETTP-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.55 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|