C34H25Cl2N2O5P — CID 11342698
5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxy-3-[3-oxo-2-(triphenyl-λ5-phosphanylidene)propyl]benzamide (PubChem CID 11342698) has the molecular formula C34H25Cl2N2O5P and a molecular weight of 643.46 g/mol. Its IUPAC name is 5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxy-3-[3-oxo-2-(triphenyl-λ5-phosphanylidene)propyl]benzamide.
| Compound Name | 5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxy-3-[3-oxo-2-(triphenyl-λ5-phosphanylidene)propyl]benzamide |
|---|---|
| PubChem CID | 11342698 |
| Molecular Formula | C34H25Cl2N2O5P |
| Molecular Weight | 643.46 g/mol |
| Exact Mass | 642.09 |
| IUPAC Name | 5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxy-3-[3-oxo-2-(triphenyl-λ5-phosphanylidene)propyl]benzamide |
| SMILES | O=CC(Cc1cc(Cl)cc(C(=O)Nc2ccc([N+](=O)[O-])cc2Cl)c1O)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H25Cl2N2O5P/c35-24-18-23(33(40)30(20-24)34(41)37-32-17-16-25(38(42)43)21-31(32)36)19-29(22-39)44(26-10-4-1-5-11-26,27-12-6-2-7-13-27)28-14-8-3-9-15-28/h1-18,20-22,40H,19H2,(H,37,41) |
| InChIKey | URZRHRBFHGEOMC-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.46 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|