C34H23Cl2N2O5P — CID 11273702
6-chloro-N-(2-chloro-4-nitrophenyl)-2-oxo-3-(triphenyl-λ5-phosphanylidene)-4H-chromene-8-carboxamide (PubChem CID 11273702) has the molecular formula C34H23Cl2N2O5P and a molecular weight of 641.45 g/mol. Its IUPAC name is 6-chloro-N-(2-chloro-4-nitrophenyl)-2-oxo-3-(triphenyl-λ5-phosphanylidene)-4H-chromene-8-carboxamide.
| Compound Name | 6-chloro-N-(2-chloro-4-nitrophenyl)-2-oxo-3-(triphenyl-λ5-phosphanylidene)-4H-chromene-8-carboxamide |
|---|---|
| PubChem CID | 11273702 |
| Molecular Formula | C34H23Cl2N2O5P |
| Molecular Weight | 641.45 g/mol |
| Exact Mass | 640.07 |
| IUPAC Name | 6-chloro-N-(2-chloro-4-nitrophenyl)-2-oxo-3-(triphenyl-λ5-phosphanylidene)-4H-chromene-8-carboxamide |
| SMILES | O=C1Oc2c(cc(Cl)cc2C(=O)Nc2ccc([N+](=O)[O-])cc2Cl)CC1=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H23Cl2N2O5P/c35-23-18-22-19-31(34(40)43-32(22)28(20-23)33(39)37-30-17-16-24(38(41)42)21-29(30)36)44(25-10-4-1-5-11-25,26-12-6-2-7-13-26)27-14-8-3-9-15-27/h1-18,20-21H,19H2,(H,37,39) |
| InChIKey | DIZJQSLXFZFACU-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.45 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|