C10H9N3O5S2 — CID 88700625
(3,5-dinitrophenyl)-(1-sulfanylidene-1,3-thiazolidin-3-yl)methanone (PubChem CID 88700625) has the molecular formula C10H9N3O5S2 and a molecular weight of 315.33 g/mol. Its IUPAC name is (3,5-dinitrophenyl)-(1-sulfanylidene-1,3-thiazolidin-3-yl)methanone.
| Compound Name | (3,5-dinitrophenyl)-(1-sulfanylidene-1,3-thiazolidin-3-yl)methanone |
|---|---|
| PubChem CID | 88700625 |
| Molecular Formula | C10H9N3O5S2 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.00 |
| IUPAC Name | (3,5-dinitrophenyl)-(1-sulfanylidene-1,3-thiazolidin-3-yl)methanone |
| SMILES | O=C(c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)N1CCS(=S)C1 |
| InChI | InChI=1S/C10H9N3O5S2/c14-10(11-1-2-20(19)6-11)7-3-8(12(15)16)5-9(4-7)13(17)18/h3-5H,1-2,6H2 |
| InChIKey | AKZQFCSCRNAHPY-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|