C17H16F2N4O5S — CID 38665066
(4-amino-3-nitrophenyl)-[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 38665066) has the molecular formula C17H16F2N4O5S and a molecular weight of 426.40 g/mol. Its IUPAC name is (4-amino-3-nitrophenyl)-[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (4-amino-3-nitrophenyl)-[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 38665066 |
| Molecular Formula | C17H16F2N4O5S |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | (4-amino-3-nitrophenyl)-[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | Nc1ccc(C(=O)N2CCN(S(=O)(=O)c3ccc(F)c(F)c3)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H16F2N4O5S/c18-13-3-2-12(10-14(13)19)29(27,28)22-7-5-21(6-8-22)17(24)11-1-4-15(20)16(9-11)23(25)26/h1-4,9-10H,5-8,20H2 |
| InChIKey | VPEHQHGRDNEFES-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 126.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.40 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|