C20H18F2N6O5S — CID 55515876
[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]-[5-methyl-1-(3-nitrophenyl)triazol-4-yl]methanone (PubChem CID 55515876) has the molecular formula C20H18F2N6O5S and a molecular weight of 492.46 g/mol. Its IUPAC name is [4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]-[5-methyl-1-(3-nitrophenyl)triazol-4-yl]methanone.
| Compound Name | [4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]-[5-methyl-1-(3-nitrophenyl)triazol-4-yl]methanone |
|---|---|
| PubChem CID | 55515876 |
| Molecular Formula | C20H18F2N6O5S |
| Molecular Weight | 492.46 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | [4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]-[5-methyl-1-(3-nitrophenyl)triazol-4-yl]methanone |
| SMILES | Cc1c(C(=O)N2CCN(S(=O)(=O)c3ccc(F)c(F)c3)CC2)nnn1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H18F2N6O5S/c1-13-19(23-24-27(13)14-3-2-4-15(11-14)28(30)31)20(29)25-7-9-26(10-8-25)34(32,33)16-5-6-17(21)18(22)12-16/h2-6,11-12H,7-10H2,1H3 |
| InChIKey | WKRRIOGPNHJPSC-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 131.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.46 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|