C22H26N8O3 — CID 31858108
[5-methyl-1-(3-nitrophenyl)triazol-4-yl]-[4-(6-methyl-2-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]methanone (PubChem CID 31858108) has the molecular formula C22H26N8O3 and a molecular weight of 450.50 g/mol. Its IUPAC name is [5-methyl-1-(3-nitrophenyl)triazol-4-yl]-[4-(6-methyl-2-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]methanone.
| Compound Name | [5-methyl-1-(3-nitrophenyl)triazol-4-yl]-[4-(6-methyl-2-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 31858108 |
| Molecular Formula | C22H26N8O3 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | [5-methyl-1-(3-nitrophenyl)triazol-4-yl]-[4-(6-methyl-2-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]methanone |
| SMILES | Cc1cc(N2CCN(C(=O)c3nnn(-c4cccc([N+](=O)[O-])c4)c3C)CC2)nc(C(C)C)n1 |
| InChI | InChI=1S/C22H26N8O3/c1-14(2)21-23-15(3)12-19(24-21)27-8-10-28(11-9-27)22(31)20-16(4)29(26-25-20)17-6-5-7-18(13-17)30(32)33/h5-7,12-14H,8-11H2,1-4H3 |
| InChIKey | VOCCJSLELRLQMN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 123.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|