C14H21N2O2S+ — CID 11922540
(8aR)-2-(4-methylphenyl)sulfonyl-1,3,4,5,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-5-ium (PubChem CID 11922540) has the molecular formula C14H21N2O2S+ and a molecular weight of 281.40 g/mol. Its IUPAC name is (8aR)-2-(4-methylphenyl)sulfonyl-1,3,4,5,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-5-ium.
| Compound Name | (8aR)-2-(4-methylphenyl)sulfonyl-1,3,4,5,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-5-ium |
|---|---|
| PubChem CID | 11922540 |
| Molecular Formula | C14H21N2O2S+ |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | (8aR)-2-(4-methylphenyl)sulfonyl-1,3,4,5,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-5-ium |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[NH+]3CCC[C@@H]3C2)cc1 |
| InChI | InChI=1S/C14H20N2O2S/c1-12-4-6-14(7-5-12)19(17,18)16-10-9-15-8-2-3-13(15)11-16/h4-7,13H,2-3,8-11H2,1H3/p+1/t13-/m1/s1 |
| InChIKey | KTVIWFIEOVGCHN-CYBMUJFWSA-O |
| XLogP | 0.05 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |