C14H20ClN2O4S2+ — CID 8818252
(3R)-3-[4-(2-chlorophenyl)sulfonylpiperazin-1-ium-1-yl]thiolane 1,1-dioxide (PubChem CID 8818252) has the molecular formula C14H20ClN2O4S2+ and a molecular weight of 379.91 g/mol. Its IUPAC name is (3R)-3-[4-(2-chlorophenyl)sulfonylpiperazin-1-ium-1-yl]thiolane 1,1-dioxide.
| Compound Name | (3R)-3-[4-(2-chlorophenyl)sulfonylpiperazin-1-ium-1-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 8818252 |
| Molecular Formula | C14H20ClN2O4S2+ |
| Molecular Weight | 379.91 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | (3R)-3-[4-(2-chlorophenyl)sulfonylpiperazin-1-ium-1-yl]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CC[C@@H]([NH+]2CCN(S(=O)(=O)c3ccccc3Cl)CC2)C1 |
| InChI | InChI=1S/C14H19ClN2O4S2/c15-13-3-1-2-4-14(13)23(20,21)17-8-6-16(7-9-17)12-5-10-22(18,19)11-12/h1-4,12H,5-11H2/p+1/t12-/m1/s1 |
| InChIKey | MRCGQJBTPUGKMK-GFCCVEGCSA-O |
| XLogP | -0.58 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.91 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |