C15H18Cl2N2O4S — CID 124705019
2,4-dichloro-5-[(3R)-3-pyrrolidin-1-ylpyrrolidin-1-yl]sulfonylbenzoic acid (PubChem CID 124705019) has the molecular formula C15H18Cl2N2O4S and a molecular weight of 393.29 g/mol. Its IUPAC name is 2,4-dichloro-5-[(3R)-3-pyrrolidin-1-ylpyrrolidin-1-yl]sulfonylbenzoic acid.
| Compound Name | 2,4-dichloro-5-[(3R)-3-pyrrolidin-1-ylpyrrolidin-1-yl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 124705019 |
| Molecular Formula | C15H18Cl2N2O4S |
| Molecular Weight | 393.29 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | 2,4-dichloro-5-[(3R)-3-pyrrolidin-1-ylpyrrolidin-1-yl]sulfonylbenzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)N2CC[C@@H](N3CCCC3)C2)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H18Cl2N2O4S/c16-12-8-13(17)14(7-11(12)15(20)21)24(22,23)19-6-3-10(9-19)18-4-1-2-5-18/h7-8,10H,1-6,9H2,(H,20,21)/t10-/m1/s1 |
| InChIKey | TVUWNJPQTAJUMP-SNVBAGLBSA-N |
| XLogP | 2.55 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |