C17H22ClFN2O4S — CID 75495736
2-chloro-3-fluoro-5-(4-piperidin-1-ylpiperidin-1-yl)sulfonylbenzoic acid (PubChem CID 75495736) has the molecular formula C17H22ClFN2O4S and a molecular weight of 404.89 g/mol. Its IUPAC name is 2-chloro-3-fluoro-5-(4-piperidin-1-ylpiperidin-1-yl)sulfonylbenzoic acid.
| Compound Name | 2-chloro-3-fluoro-5-(4-piperidin-1-ylpiperidin-1-yl)sulfonylbenzoic acid |
|---|---|
| PubChem CID | 75495736 |
| Molecular Formula | C17H22ClFN2O4S |
| Molecular Weight | 404.89 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 2-chloro-3-fluoro-5-(4-piperidin-1-ylpiperidin-1-yl)sulfonylbenzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)N2CCC(N3CCCCC3)CC2)cc(F)c1Cl |
| InChI | InChI=1S/C17H22ClFN2O4S/c18-16-14(17(22)23)10-13(11-15(16)19)26(24,25)21-8-4-12(5-9-21)20-6-2-1-3-7-20/h10-12H,1-9H2,(H,22,23) |
| InChIKey | FTGRNAYMQAYLLL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.89 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |