C17H15ClFNO4S — CID 99702645
2-chloro-3-fluoro-5-[(3S)-3-phenylpyrrolidin-1-yl]sulfonylbenzoic acid (PubChem CID 99702645) has the molecular formula C17H15ClFNO4S and a molecular weight of 383.83 g/mol. Its IUPAC name is 2-chloro-3-fluoro-5-[(3S)-3-phenylpyrrolidin-1-yl]sulfonylbenzoic acid.
| Compound Name | 2-chloro-3-fluoro-5-[(3S)-3-phenylpyrrolidin-1-yl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 99702645 |
| Molecular Formula | C17H15ClFNO4S |
| Molecular Weight | 383.83 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | 2-chloro-3-fluoro-5-[(3S)-3-phenylpyrrolidin-1-yl]sulfonylbenzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)N2CC[C@@H](c3ccccc3)C2)cc(F)c1Cl |
| InChI | InChI=1S/C17H15ClFNO4S/c18-16-14(17(21)22)8-13(9-15(16)19)25(23,24)20-7-6-12(10-20)11-4-2-1-3-5-11/h1-5,8-9,12H,6-7,10H2,(H,21,22)/t12-/m1/s1 |
| InChIKey | VIVZOZLWSMUADR-GFCCVEGCSA-N |
| XLogP | 3.36 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.83 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |