C21H35NO3S — CID 35202417
(3S,5S)-1-(4-butoxy-3-tert-butylphenyl)sulfonyl-3,5-dimethylpiperidine (PubChem CID 35202417) has the molecular formula C21H35NO3S and a molecular weight of 381.58 g/mol. Its IUPAC name is (3S,5S)-1-(4-butoxy-3-tert-butylphenyl)sulfonyl-3,5-dimethylpiperidine.
| Compound Name | (3S,5S)-1-(4-butoxy-3-tert-butylphenyl)sulfonyl-3,5-dimethylpiperidine |
|---|---|
| PubChem CID | 35202417 |
| Molecular Formula | C21H35NO3S |
| Molecular Weight | 381.58 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | (3S,5S)-1-(4-butoxy-3-tert-butylphenyl)sulfonyl-3,5-dimethylpiperidine |
| SMILES | CCCCOc1ccc(S(=O)(=O)N2C[C@@H](C)C[C@H](C)C2)cc1C(C)(C)C |
| InChI | InChI=1S/C21H35NO3S/c1-7-8-11-25-20-10-9-18(13-19(20)21(4,5)6)26(23,24)22-14-16(2)12-17(3)15-22/h9-10,13,16-17H,7-8,11-12,14-15H2,1-6H3/t16-,17-/m0/s1 |
| InChIKey | OYPSGONUYNEJFH-IRXDYDNUSA-N |
| XLogP | 4.83 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.58 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|