C17H27NO4S — CID 91670208
1-(2,5-diethoxyphenyl)sulfonyl-3,5-dimethylpiperidine (PubChem CID 91670208) has the molecular formula C17H27NO4S and a molecular weight of 341.47 g/mol. Its IUPAC name is 1-(2,5-diethoxyphenyl)sulfonyl-3,5-dimethylpiperidine.
| Compound Name | 1-(2,5-diethoxyphenyl)sulfonyl-3,5-dimethylpiperidine |
|---|---|
| PubChem CID | 91670208 |
| Molecular Formula | C17H27NO4S |
| Molecular Weight | 341.47 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 1-(2,5-diethoxyphenyl)sulfonyl-3,5-dimethylpiperidine |
| SMILES | CCOc1ccc(OCC)c(S(=O)(=O)N2CC(C)CC(C)C2)c1 |
| InChI | InChI=1S/C17H27NO4S/c1-5-21-15-7-8-16(22-6-2)17(10-15)23(19,20)18-11-13(3)9-14(4)12-18/h7-8,10,13-14H,5-6,9,11-12H2,1-4H3 |
| InChIKey | KKTYZQNAOKVJMN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |