C16H25NO4S — CID 66486191
1-(2,5-diethoxyphenyl)sulfonyl-3-methylpiperidine (PubChem CID 66486191) has the molecular formula C16H25NO4S and a molecular weight of 327.45 g/mol. Its IUPAC name is 1-(2,5-diethoxyphenyl)sulfonyl-3-methylpiperidine.
| Compound Name | 1-(2,5-diethoxyphenyl)sulfonyl-3-methylpiperidine |
|---|---|
| PubChem CID | 66486191 |
| Molecular Formula | C16H25NO4S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 1-(2,5-diethoxyphenyl)sulfonyl-3-methylpiperidine |
| SMILES | CCOc1ccc(OCC)c(S(=O)(=O)N2CCCC(C)C2)c1 |
| InChI | InChI=1S/C16H25NO4S/c1-4-20-14-8-9-15(21-5-2)16(11-14)22(18,19)17-10-6-7-13(3)12-17/h8-9,11,13H,4-7,10,12H2,1-3H3 |
| InChIKey | HPVKZKXIEYKBOW-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |