C17H25N5O4S — CID 3191920
1-[2,5-diethoxy-4-(tetrazol-1-yl)phenyl]sulfonyl-3-methylpiperidine (PubChem CID 3191920) has the molecular formula C17H25N5O4S and a molecular weight of 395.49 g/mol. Its IUPAC name is 1-[2,5-diethoxy-4-(tetrazol-1-yl)phenyl]sulfonyl-3-methylpiperidine.
| Compound Name | 1-[2,5-diethoxy-4-(tetrazol-1-yl)phenyl]sulfonyl-3-methylpiperidine |
|---|---|
| PubChem CID | 3191920 |
| Molecular Formula | C17H25N5O4S |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 1-[2,5-diethoxy-4-(tetrazol-1-yl)phenyl]sulfonyl-3-methylpiperidine |
| SMILES | CCOc1cc(S(=O)(=O)N2CCCC(C)C2)c(OCC)cc1-n1cnnn1 |
| InChI | InChI=1S/C17H25N5O4S/c1-4-25-15-10-17(27(23,24)21-8-6-7-13(3)11-21)16(26-5-2)9-14(15)22-12-18-19-20-22/h9-10,12-13H,4-8,11H2,1-3H3 |
| InChIKey | DMXUWMZILQUPKJ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 99.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |