C18H30N2O5S — CID 110602206
4-(3,4-dimethoxyphenyl)sulfonyl-1-(3-methoxypropyl)-2,6-dimethylpiperazine (PubChem CID 110602206) has the molecular formula C18H30N2O5S and a molecular weight of 386.51 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)sulfonyl-1-(3-methoxypropyl)-2,6-dimethylpiperazine.
| Compound Name | 4-(3,4-dimethoxyphenyl)sulfonyl-1-(3-methoxypropyl)-2,6-dimethylpiperazine |
|---|---|
| PubChem CID | 110602206 |
| Molecular Formula | C18H30N2O5S |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)sulfonyl-1-(3-methoxypropyl)-2,6-dimethylpiperazine |
| SMILES | COCCCN1C(C)CN(S(=O)(=O)c2ccc(OC)c(OC)c2)CC1C |
| InChI | InChI=1S/C18H30N2O5S/c1-14-12-19(13-15(2)20(14)9-6-10-23-3)26(21,22)16-7-8-17(24-4)18(11-16)25-5/h7-8,11,14-15H,6,9-10,12-13H2,1-5H3 |
| InChIKey | OKPTXZQRJGOTBW-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|