C16H25ClN2O3S — CID 110602234
4-(3-chlorophenyl)sulfonyl-1-(3-methoxypropyl)-2,6-dimethylpiperazine (PubChem CID 110602234) has the molecular formula C16H25ClN2O3S and a molecular weight of 360.91 g/mol. Its IUPAC name is 4-(3-chlorophenyl)sulfonyl-1-(3-methoxypropyl)-2,6-dimethylpiperazine.
| Compound Name | 4-(3-chlorophenyl)sulfonyl-1-(3-methoxypropyl)-2,6-dimethylpiperazine |
|---|---|
| PubChem CID | 110602234 |
| Molecular Formula | C16H25ClN2O3S |
| Molecular Weight | 360.91 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 4-(3-chlorophenyl)sulfonyl-1-(3-methoxypropyl)-2,6-dimethylpiperazine |
| SMILES | COCCCN1C(C)CN(S(=O)(=O)c2cccc(Cl)c2)CC1C |
| InChI | InChI=1S/C16H25ClN2O3S/c1-13-11-18(12-14(2)19(13)8-5-9-22-3)23(20,21)16-7-4-6-15(17)10-16/h4,6-7,10,13-14H,5,8-9,11-12H2,1-3H3 |
| InChIKey | UJCQLQAMRXYLCI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.91 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|