C15H22ClN3O4S — CID 119678902
1-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-2-(2-methoxyethylamino)ethanone (PubChem CID 119678902) has the molecular formula C15H22ClN3O4S and a molecular weight of 375.88 g/mol. Its IUPAC name is 1-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-2-(2-methoxyethylamino)ethanone.
| Compound Name | 1-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-2-(2-methoxyethylamino)ethanone |
|---|---|
| PubChem CID | 119678902 |
| Molecular Formula | C15H22ClN3O4S |
| Molecular Weight | 375.88 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 1-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-2-(2-methoxyethylamino)ethanone |
| SMILES | COCCNCC(=O)N1CCN(S(=O)(=O)c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C15H22ClN3O4S/c1-23-10-5-17-12-15(20)18-6-8-19(9-7-18)24(21,22)14-4-2-3-13(16)11-14/h2-4,11,17H,5-10,12H2,1H3 |
| InChIKey | RCWWSZWSWYCABX-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.88 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|