C16H23ClN4O4S — CID 9327013
[5-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-5-oxopentyl]urea (PubChem CID 9327013) has the molecular formula C16H23ClN4O4S and a molecular weight of 402.90 g/mol. Its IUPAC name is [5-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-5-oxopentyl]urea.
| Compound Name | [5-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-5-oxopentyl]urea |
|---|---|
| PubChem CID | 9327013 |
| Molecular Formula | C16H23ClN4O4S |
| Molecular Weight | 402.90 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | [5-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-5-oxopentyl]urea |
| SMILES | NC(=O)NCCCCC(=O)N1CCN(S(=O)(=O)c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C16H23ClN4O4S/c17-13-4-3-5-14(12-13)26(24,25)21-10-8-20(9-11-21)15(22)6-1-2-7-19-16(18)23/h3-5,12H,1-2,6-11H2,(H3,18,19,23) |
| InChIKey | FGWXYNMOTUFLDK-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.90 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|