C19H28ClN3O4S — CID 56520724
5-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-N,N-diethyl-5-oxopentanamide (PubChem CID 56520724) has the molecular formula C19H28ClN3O4S and a molecular weight of 429.97 g/mol. Its IUPAC name is 5-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-N,N-diethyl-5-oxopentanamide.
| Compound Name | 5-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-N,N-diethyl-5-oxopentanamide |
|---|---|
| PubChem CID | 56520724 |
| Molecular Formula | C19H28ClN3O4S |
| Molecular Weight | 429.97 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | 5-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-N,N-diethyl-5-oxopentanamide |
| SMILES | CCN(CC)C(=O)CCCC(=O)N1CCN(S(=O)(=O)c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C19H28ClN3O4S/c1-3-21(4-2)18(24)9-6-10-19(25)22-11-13-23(14-12-22)28(26,27)17-8-5-7-16(20)15-17/h5,7-8,15H,3-4,6,9-14H2,1-2H3 |
| InChIKey | YGWHGTSZNMANQJ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.97 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |