C19H22ClN3O4S2 — CID 30485429
N-[4-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-4-oxobutyl]thiophene-3-carboxamide (PubChem CID 30485429) has the molecular formula C19H22ClN3O4S2 and a molecular weight of 455.99 g/mol. Its IUPAC name is N-[4-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-4-oxobutyl]thiophene-3-carboxamide.
| Compound Name | N-[4-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-4-oxobutyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 30485429 |
| Molecular Formula | C19H22ClN3O4S2 |
| Molecular Weight | 455.99 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | N-[4-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-4-oxobutyl]thiophene-3-carboxamide |
| SMILES | O=C(NCCCC(=O)N1CCN(S(=O)(=O)c2cccc(Cl)c2)CC1)c1ccsc1 |
| InChI | InChI=1S/C19H22ClN3O4S2/c20-16-3-1-4-17(13-16)29(26,27)23-10-8-22(9-11-23)18(24)5-2-7-21-19(25)15-6-12-28-14-15/h1,3-4,6,12-14H,2,5,7-11H2,(H,21,25) |
| InChIKey | INLAKWBLDNRZJN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.99 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|