C20H21Cl2N3O3S — CID 46413247
N-[4-[4-(3,5-dichlorobenzoyl)piperazin-1-yl]-4-oxobutyl]thiophene-3-carboxamide (PubChem CID 46413247) has the molecular formula C20H21Cl2N3O3S and a molecular weight of 454.38 g/mol. Its IUPAC name is N-[4-[4-(3,5-dichlorobenzoyl)piperazin-1-yl]-4-oxobutyl]thiophene-3-carboxamide.
| Compound Name | N-[4-[4-(3,5-dichlorobenzoyl)piperazin-1-yl]-4-oxobutyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 46413247 |
| Molecular Formula | C20H21Cl2N3O3S |
| Molecular Weight | 454.38 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | N-[4-[4-(3,5-dichlorobenzoyl)piperazin-1-yl]-4-oxobutyl]thiophene-3-carboxamide |
| SMILES | O=C(NCCCC(=O)N1CCN(C(=O)c2cc(Cl)cc(Cl)c2)CC1)c1ccsc1 |
| InChI | InChI=1S/C20H21Cl2N3O3S/c21-16-10-15(11-17(22)12-16)20(28)25-7-5-24(6-8-25)18(26)2-1-4-23-19(27)14-3-9-29-13-14/h3,9-13H,1-2,4-8H2,(H,23,27) |
| InChIKey | OCXCGJYIKRRPKB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|