C14H18N2O5S — CID 119240043
4-[4-(thiophene-3-carbonylamino)butanoyl]morpholine-2-carboxylic acid (PubChem CID 119240043) has the molecular formula C14H18N2O5S and a molecular weight of 326.37 g/mol. Its IUPAC name is 4-[4-(thiophene-3-carbonylamino)butanoyl]morpholine-2-carboxylic acid.
| Compound Name | 4-[4-(thiophene-3-carbonylamino)butanoyl]morpholine-2-carboxylic acid |
|---|---|
| PubChem CID | 119240043 |
| Molecular Formula | C14H18N2O5S |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 4-[4-(thiophene-3-carbonylamino)butanoyl]morpholine-2-carboxylic acid |
| SMILES | O=C(NCCCC(=O)N1CCOC(C(=O)O)C1)c1ccsc1 |
| InChI | InChI=1S/C14H18N2O5S/c17-12(16-5-6-21-11(8-16)14(19)20)2-1-4-15-13(18)10-3-7-22-9-10/h3,7,9,11H,1-2,4-6,8H2,(H,15,18)(H,19,20) |
| InChIKey | SBNFKQQEHLTNSE-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|