C15H18ClN3O4S2 — CID 9086296
3-[2-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-1,3-thiazolidin-2-one (PubChem CID 9086296) has the molecular formula C15H18ClN3O4S2 and a molecular weight of 403.91 g/mol. Its IUPAC name is 3-[2-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-1,3-thiazolidin-2-one.
| Compound Name | 3-[2-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 9086296 |
| Molecular Formula | C15H18ClN3O4S2 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | 3-[2-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-1,3-thiazolidin-2-one |
| SMILES | O=C(CN1CCSC1=O)N1CCN(S(=O)(=O)c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C15H18ClN3O4S2/c16-12-2-1-3-13(10-12)25(22,23)19-6-4-17(5-7-19)14(20)11-18-8-9-24-15(18)21/h1-3,10H,4-9,11H2 |
| InChIKey | CTDQROKXDRNQNK-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|