C15H21ClN2O3S2 — CID 55822268
1-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-2-propylsulfanylethanone (PubChem CID 55822268) has the molecular formula C15H21ClN2O3S2 and a molecular weight of 376.93 g/mol. Its IUPAC name is 1-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-2-propylsulfanylethanone.
| Compound Name | 1-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-2-propylsulfanylethanone |
|---|---|
| PubChem CID | 55822268 |
| Molecular Formula | C15H21ClN2O3S2 |
| Molecular Weight | 376.93 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 1-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-2-propylsulfanylethanone |
| SMILES | CCCSCC(=O)N1CCN(S(=O)(=O)c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C15H21ClN2O3S2/c1-2-10-22-12-15(19)17-6-8-18(9-7-17)23(20,21)14-5-3-4-13(16)11-14/h3-5,11H,2,6-10,12H2,1H3 |
| InChIKey | DACROPMEJVVZHA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.93 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|