C16H24N2O3S2 — CID 55821892
1-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-2-propylsulfanylethanone (PubChem CID 55821892) has the molecular formula C16H24N2O3S2 and a molecular weight of 356.51 g/mol. Its IUPAC name is 1-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-2-propylsulfanylethanone.
| Compound Name | 1-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-2-propylsulfanylethanone |
|---|---|
| PubChem CID | 55821892 |
| Molecular Formula | C16H24N2O3S2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 1-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-2-propylsulfanylethanone |
| SMILES | CCCSCC(=O)N1CCN(S(=O)(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C16H24N2O3S2/c1-3-12-22-13-16(19)17-8-10-18(11-9-17)23(20,21)15-6-4-14(2)5-7-15/h4-7H,3,8-13H2,1-2H3 |
| InChIKey | VLMWACRDEVLLMK-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|