C16H19Cl2N3O4S2 — CID 46636580
3-[3-[4-(2,6-dichlorophenyl)sulfonylpiperazin-1-yl]-3-oxopropyl]-1,3-thiazolidin-2-one (PubChem CID 46636580) has the molecular formula C16H19Cl2N3O4S2 and a molecular weight of 452.39 g/mol. Its IUPAC name is 3-[3-[4-(2,6-dichlorophenyl)sulfonylpiperazin-1-yl]-3-oxopropyl]-1,3-thiazolidin-2-one.
| Compound Name | 3-[3-[4-(2,6-dichlorophenyl)sulfonylpiperazin-1-yl]-3-oxopropyl]-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 46636580 |
| Molecular Formula | C16H19Cl2N3O4S2 |
| Molecular Weight | 452.39 g/mol |
| Exact Mass | 451.02 |
| IUPAC Name | 3-[3-[4-(2,6-dichlorophenyl)sulfonylpiperazin-1-yl]-3-oxopropyl]-1,3-thiazolidin-2-one |
| SMILES | O=C(CCN1CCSC1=O)N1CCN(S(=O)(=O)c2c(Cl)cccc2Cl)CC1 |
| InChI | InChI=1S/C16H19Cl2N3O4S2/c17-12-2-1-3-13(18)15(12)27(24,25)21-8-6-19(7-9-21)14(22)4-5-20-10-11-26-16(20)23/h1-3H,4-11H2 |
| InChIKey | CFCOWSXHBKKVOP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|