C20H24N4O4S2 — CID 55614987
3-[3-[4-(3-methylquinolin-8-yl)sulfonylpiperazin-1-yl]-3-oxopropyl]-1,3-thiazolidin-2-one (PubChem CID 55614987) has the molecular formula C20H24N4O4S2 and a molecular weight of 448.57 g/mol. Its IUPAC name is 3-[3-[4-(3-methylquinolin-8-yl)sulfonylpiperazin-1-yl]-3-oxopropyl]-1,3-thiazolidin-2-one.
| Compound Name | 3-[3-[4-(3-methylquinolin-8-yl)sulfonylpiperazin-1-yl]-3-oxopropyl]-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 55614987 |
| Molecular Formula | C20H24N4O4S2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 3-[3-[4-(3-methylquinolin-8-yl)sulfonylpiperazin-1-yl]-3-oxopropyl]-1,3-thiazolidin-2-one |
| SMILES | Cc1cnc2c(S(=O)(=O)N3CCN(C(=O)CCN4CCSC4=O)CC3)cccc2c1 |
| InChI | InChI=1S/C20H24N4O4S2/c1-15-13-16-3-2-4-17(19(16)21-14-15)30(27,28)24-9-7-22(8-10-24)18(25)5-6-23-11-12-29-20(23)26/h2-4,13-14H,5-12H2,1H3 |
| InChIKey | YUUQUWQBMJRRKP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 90.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|