C19H18BrN3O3S2 — CID 39276916
(5-bromothiophen-2-yl)-[4-(3-methylquinolin-8-yl)sulfonylpiperazin-1-yl]methanone (PubChem CID 39276916) has the molecular formula C19H18BrN3O3S2 and a molecular weight of 480.41 g/mol. Its IUPAC name is (5-bromothiophen-2-yl)-[4-(3-methylquinolin-8-yl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (5-bromothiophen-2-yl)-[4-(3-methylquinolin-8-yl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 39276916 |
| Molecular Formula | C19H18BrN3O3S2 |
| Molecular Weight | 480.41 g/mol |
| Exact Mass | 479.00 |
| IUPAC Name | (5-bromothiophen-2-yl)-[4-(3-methylquinolin-8-yl)sulfonylpiperazin-1-yl]methanone |
| SMILES | Cc1cnc2c(S(=O)(=O)N3CCN(C(=O)c4ccc(Br)s4)CC3)cccc2c1 |
| InChI | InChI=1S/C19H18BrN3O3S2/c1-13-11-14-3-2-4-16(18(14)21-12-13)28(25,26)23-9-7-22(8-10-23)19(24)15-5-6-17(20)27-15/h2-6,11-12H,7-10H2,1H3 |
| InChIKey | MGLAVTFVERDKFF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |