C18H25ClN4O3S — CID 119293056
4-amino-1-[4-(3-methylquinolin-8-yl)sulfonylpiperazin-1-yl]butan-1-one;hydrochloride (PubChem CID 119293056) has the molecular formula C18H25ClN4O3S and a molecular weight of 412.94 g/mol. Its IUPAC name is 4-amino-1-[4-(3-methylquinolin-8-yl)sulfonylpiperazin-1-yl]butan-1-one;hydrochloride.
| Compound Name | 4-amino-1-[4-(3-methylquinolin-8-yl)sulfonylpiperazin-1-yl]butan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119293056 |
| Molecular Formula | C18H25ClN4O3S |
| Molecular Weight | 412.94 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 4-amino-1-[4-(3-methylquinolin-8-yl)sulfonylpiperazin-1-yl]butan-1-one;hydrochloride |
| SMILES | Cc1cnc2c(S(=O)(=O)N3CCN(C(=O)CCCN)CC3)cccc2c1.Cl |
| InChI | InChI=1S/C18H24N4O3S.ClH/c1-14-12-15-4-2-5-16(18(15)20-13-14)26(24,25)22-10-8-21(9-11-22)17(23)6-3-7-19;/h2,4-5,12-13H,3,6-11,19H2,1H3;1H |
| InChIKey | CSVCHBIPISPEPV-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 96.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.94 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |