C20H28N4O3S — CID 33346978
N,N-diethyl-2-[4-(3-methylquinolin-8-yl)sulfonylpiperazin-1-yl]acetamide (PubChem CID 33346978) has the molecular formula C20H28N4O3S and a molecular weight of 404.54 g/mol. Its IUPAC name is N,N-diethyl-2-[4-(3-methylquinolin-8-yl)sulfonylpiperazin-1-yl]acetamide.
| Compound Name | N,N-diethyl-2-[4-(3-methylquinolin-8-yl)sulfonylpiperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 33346978 |
| Molecular Formula | C20H28N4O3S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | N,N-diethyl-2-[4-(3-methylquinolin-8-yl)sulfonylpiperazin-1-yl]acetamide |
| SMILES | CCN(CC)C(=O)CN1CCN(S(=O)(=O)c2cccc3cc(C)cnc23)CC1 |
| InChI | InChI=1S/C20H28N4O3S/c1-4-23(5-2)19(25)15-22-9-11-24(12-10-22)28(26,27)18-8-6-7-17-13-16(3)14-21-20(17)18/h6-8,13-14H,4-5,9-12,15H2,1-3H3 |
| InChIKey | SYVXWHFVJVASJI-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |