C24H27FN4O3S — CID 31990964
N-[2-(4-fluorophenyl)ethyl]-2-[4-(3-methylquinolin-8-yl)sulfonylpiperazin-1-yl]acetamide (PubChem CID 31990964) has the molecular formula C24H27FN4O3S and a molecular weight of 470.57 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-2-[4-(3-methylquinolin-8-yl)sulfonylpiperazin-1-yl]acetamide.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-2-[4-(3-methylquinolin-8-yl)sulfonylpiperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 31990964 |
| Molecular Formula | C24H27FN4O3S |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-2-[4-(3-methylquinolin-8-yl)sulfonylpiperazin-1-yl]acetamide |
| SMILES | Cc1cnc2c(S(=O)(=O)N3CCN(CC(=O)NCCc4ccc(F)cc4)CC3)cccc2c1 |
| InChI | InChI=1S/C24H27FN4O3S/c1-18-15-20-3-2-4-22(24(20)27-16-18)33(31,32)29-13-11-28(12-14-29)17-23(30)26-10-9-19-5-7-21(25)8-6-19/h2-8,15-16H,9-14,17H2,1H3,(H,26,30) |
| InChIKey | GLEYLYUHGXNQOY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |