C22H29N5O2S — CID 56550580
3-methyl-8-[4-(5-pyrazol-1-ylpentyl)piperazin-1-yl]sulfonylquinoline (PubChem CID 56550580) has the molecular formula C22H29N5O2S and a molecular weight of 427.57 g/mol. Its IUPAC name is 3-methyl-8-[4-(5-pyrazol-1-ylpentyl)piperazin-1-yl]sulfonylquinoline.
| Compound Name | 3-methyl-8-[4-(5-pyrazol-1-ylpentyl)piperazin-1-yl]sulfonylquinoline |
|---|---|
| PubChem CID | 56550580 |
| Molecular Formula | C22H29N5O2S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 3-methyl-8-[4-(5-pyrazol-1-ylpentyl)piperazin-1-yl]sulfonylquinoline |
| SMILES | Cc1cnc2c(S(=O)(=O)N3CCN(CCCCCn4cccn4)CC3)cccc2c1 |
| InChI | InChI=1S/C22H29N5O2S/c1-19-17-20-7-5-8-21(22(20)23-18-19)30(28,29)27-15-13-25(14-16-27)10-3-2-4-11-26-12-6-9-24-26/h5-9,12,17-18H,2-4,10-11,13-16H2,1H3 |
| InChIKey | YXRZITLIYUVGED-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|