C22H22N4O2S — CID 31992064
3-[[4-(3-methylquinolin-8-yl)sulfonylpiperazin-1-yl]methyl]benzonitrile (PubChem CID 31992064) has the molecular formula C22H22N4O2S and a molecular weight of 406.51 g/mol. Its IUPAC name is 3-[[4-(3-methylquinolin-8-yl)sulfonylpiperazin-1-yl]methyl]benzonitrile.
| Compound Name | 3-[[4-(3-methylquinolin-8-yl)sulfonylpiperazin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 31992064 |
| Molecular Formula | C22H22N4O2S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 3-[[4-(3-methylquinolin-8-yl)sulfonylpiperazin-1-yl]methyl]benzonitrile |
| SMILES | Cc1cnc2c(S(=O)(=O)N3CCN(Cc4cccc(C#N)c4)CC3)cccc2c1 |
| InChI | InChI=1S/C22H22N4O2S/c1-17-12-20-6-3-7-21(22(20)24-15-17)29(27,28)26-10-8-25(9-11-26)16-19-5-2-4-18(13-19)14-23/h2-7,12-13,15H,8-11,16H2,1H3 |
| InChIKey | UKZLVQQWQRJBAZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 77.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |