C21H31N3O4S2 — CID 24515613
3-[3-oxo-3-[4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazin-1-yl]propyl]-1,3-thiazolidin-2-one (PubChem CID 24515613) has the molecular formula C21H31N3O4S2 and a molecular weight of 453.63 g/mol. Its IUPAC name is 3-[3-oxo-3-[4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazin-1-yl]propyl]-1,3-thiazolidin-2-one.
| Compound Name | 3-[3-oxo-3-[4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazin-1-yl]propyl]-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 24515613 |
| Molecular Formula | C21H31N3O4S2 |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 3-[3-oxo-3-[4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazin-1-yl]propyl]-1,3-thiazolidin-2-one |
| SMILES | Cc1c(C)c(C)c(S(=O)(=O)N2CCN(C(=O)CCN3CCSC3=O)CC2)c(C)c1C |
| InChI | InChI=1S/C21H31N3O4S2/c1-14-15(2)17(4)20(18(5)16(14)3)30(27,28)24-10-8-22(9-11-24)19(25)6-7-23-12-13-29-21(23)26/h6-13H2,1-5H3 |
| InChIKey | XOXHPPLQGQLFKK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|