C13H21N3O6S2 — CID 55463204
[2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl] 3-(2-oxo-1,3-thiazolidin-3-yl)propanoate (PubChem CID 55463204) has the molecular formula C13H21N3O6S2 and a molecular weight of 379.46 g/mol. Its IUPAC name is [2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl] 3-(2-oxo-1,3-thiazolidin-3-yl)propanoate.
| Compound Name | [2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl] 3-(2-oxo-1,3-thiazolidin-3-yl)propanoate |
|---|---|
| PubChem CID | 55463204 |
| Molecular Formula | C13H21N3O6S2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | [2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl] 3-(2-oxo-1,3-thiazolidin-3-yl)propanoate |
| SMILES | CS(=O)(=O)N1CCN(C(=O)COC(=O)CCN2CCSC2=O)CC1 |
| InChI | InChI=1S/C13H21N3O6S2/c1-24(20,21)16-6-4-14(5-7-16)11(17)10-22-12(18)2-3-15-8-9-23-13(15)19/h2-10H2,1H3 |
| InChIKey | FUWLQOWOWSALLS-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 104.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|