C18H22FN3O4S — CID 55442865
[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 3-(2-oxo-1,3-thiazolidin-3-yl)propanoate (PubChem CID 55442865) has the molecular formula C18H22FN3O4S and a molecular weight of 395.46 g/mol. Its IUPAC name is [2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 3-(2-oxo-1,3-thiazolidin-3-yl)propanoate.
| Compound Name | [2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 3-(2-oxo-1,3-thiazolidin-3-yl)propanoate |
|---|---|
| PubChem CID | 55442865 |
| Molecular Formula | C18H22FN3O4S |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | [2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 3-(2-oxo-1,3-thiazolidin-3-yl)propanoate |
| SMILES | O=C(CCN1CCSC1=O)OCC(=O)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C18H22FN3O4S/c19-14-3-1-2-4-15(14)20-7-9-21(10-8-20)16(23)13-26-17(24)5-6-22-11-12-27-18(22)25/h1-4H,5-13H2 |
| InChIKey | QRVRAHBUCVIAEN-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|