C12H20N2O3S — CID 94051371
3-[3-[(2R,5S)-2,5-dimethylmorpholin-4-yl]-3-oxopropyl]-1,3-thiazolidin-2-one (PubChem CID 94051371) has the molecular formula C12H20N2O3S and a molecular weight of 272.37 g/mol. Its IUPAC name is 3-[3-[(2R,5S)-2,5-dimethylmorpholin-4-yl]-3-oxopropyl]-1,3-thiazolidin-2-one.
| Compound Name | 3-[3-[(2R,5S)-2,5-dimethylmorpholin-4-yl]-3-oxopropyl]-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 94051371 |
| Molecular Formula | C12H20N2O3S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 3-[3-[(2R,5S)-2,5-dimethylmorpholin-4-yl]-3-oxopropyl]-1,3-thiazolidin-2-one |
| SMILES | C[C@@H]1CN(C(=O)CCN2CCSC2=O)[C@@H](C)CO1 |
| InChI | InChI=1S/C12H20N2O3S/c1-9-8-17-10(2)7-14(9)11(15)3-4-13-5-6-18-12(13)16/h9-10H,3-8H2,1-2H3/t9-,10+/m0/s1 |
| InChIKey | VKRVAIONCXPBSK-VHSXEESVSA-N |
| XLogP | 1.18 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|