C15H26N2O3 — CID 51081736
1-[2-(2,5-dimethylmorpholin-4-yl)-2-oxoethyl]azocan-2-one (PubChem CID 51081736) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is 1-[2-(2,5-dimethylmorpholin-4-yl)-2-oxoethyl]azocan-2-one.
| Compound Name | 1-[2-(2,5-dimethylmorpholin-4-yl)-2-oxoethyl]azocan-2-one |
|---|---|
| PubChem CID | 51081736 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 1-[2-(2,5-dimethylmorpholin-4-yl)-2-oxoethyl]azocan-2-one |
| SMILES | CC1CN(C(=O)CN2CCCCCCC2=O)C(C)CO1 |
| InChI | InChI=1S/C15H26N2O3/c1-12-11-20-13(2)9-17(12)15(19)10-16-8-6-4-3-5-7-14(16)18/h12-13H,3-11H2,1-2H3 |
| InChIKey | LSFXIKUQKTUEFN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |