C14H21Cl2N3O3S — CID 110308375
4-[(5,6-dichloro-3-pyridinyl)sulfonyl]-1-(2-methoxyethyl)-2,6-dimethylpiperazine (PubChem CID 110308375) has the molecular formula C14H21Cl2N3O3S and a molecular weight of 382.31 g/mol. Its IUPAC name is 4-[(5,6-dichloro-3-pyridinyl)sulfonyl]-1-(2-methoxyethyl)-2,6-dimethylpiperazine.
| Compound Name | 4-[(5,6-dichloro-3-pyridinyl)sulfonyl]-1-(2-methoxyethyl)-2,6-dimethylpiperazine |
|---|---|
| PubChem CID | 110308375 |
| Molecular Formula | C14H21Cl2N3O3S |
| Molecular Weight | 382.31 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 4-[(5,6-dichloro-3-pyridinyl)sulfonyl]-1-(2-methoxyethyl)-2,6-dimethylpiperazine |
| SMILES | COCCN1C(C)CN(S(=O)(=O)c2cnc(Cl)c(Cl)c2)CC1C |
| InChI | InChI=1S/C14H21Cl2N3O3S/c1-10-8-18(9-11(2)19(10)4-5-22-3)23(20,21)12-6-13(15)14(16)17-7-12/h6-7,10-11H,4-5,8-9H2,1-3H3 |
| InChIKey | GMMITWKWRJASDC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|