About 4-cyclopentylsulfonyl-1-(3-methoxypropyl)-2,6-dimethylpiperazine
4-cyclopentylsulfonyl-1-(3-methoxypropyl)-2,6-dimethylpiperazine (PubChem CID 110616538) has the molecular formula C15H30N2O3S
and a molecular weight of 318.48 g/mol. Its IUPAC name is 4-cyclopentylsulfonyl-1-(3-methoxypropyl)-2,6-dimethylpiperazine.
Molecular Properties
| Compound Name | 4-cyclopentylsulfonyl-1-(3-methoxypropyl)-2,6-dimethylpiperazine |
| PubChem CID | 110616538 |
| Molecular Formula | C15H30N2O3S |
| Molecular Weight | 318.48 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | 4-cyclopentylsulfonyl-1-(3-methoxypropyl)-2,6-dimethylpiperazine |
| SMILES | COCCCN1C(C)CN(S(=O)(=O)C2CCCC2)CC1C |
| InChI | InChI=1S/C15H30N2O3S/c1-13-11-16(21(18,19)15-7-4-5-8-15)12-14(2)17(13)9-6-10-20-3/h13-15H,4-12H2,1-3H3 |
| InChIKey | ZQHUNKYLYVKPSL-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.48 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclopentylsulfonyl-1-(3-methoxypropyl)-2,6-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopentylsulfonyl-1-(3-methoxypropyl)-2,6-dimethylpiperazine?
The IUPAC name of 4-cyclopentylsulfonyl-1-(3-methoxypropyl)-2,6-dimethylpiperazine (CID 110616538) is 4-cyclopentylsulfonyl-1-(3-methoxypropyl)-2,6-dimethylpiperazine.
What is the SMILES notation for 4-cyclopentylsulfonyl-1-(3-methoxypropyl)-2,6-dimethylpiperazine?
The canonical SMILES for 4-cyclopentylsulfonyl-1-(3-methoxypropyl)-2,6-dimethylpiperazine is COCCCN1C(C)CN(S(=O)(=O)C2CCCC2)CC1C.
What is the InChIKey of 4-cyclopentylsulfonyl-1-(3-methoxypropyl)-2,6-dimethylpiperazine?
The InChIKey is ZQHUNKYLYVKPSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30N2O3S/c1-13-11-16(21(18,19)15-7-4-5-8-15)12-14(2)17(13)9-6-10-20-3/h13-15H,4-12H2,1-3H3.
What are the key properties of 4-cyclopentylsulfonyl-1-(3-methoxypropyl)-2,6-dimethylpiperazine?
4-cyclopentylsulfonyl-1-(3-methoxypropyl)-2,6-dimethylpiperazine has a molecular weight of 318.48 g/mol, XLogP of 1.69, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopentylsulfonyl-1-(3-methoxypropyl)-2,6-dimethylpiperazine is sourced from PubChem (CID 110616538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).