C12H26N2O3S — CID 110413041
4-ethylsulfonyl-1-(3-methoxypropyl)-2,6-dimethylpiperazine (PubChem CID 110413041) has the molecular formula C12H26N2O3S and a molecular weight of 278.42 g/mol. Its IUPAC name is 4-ethylsulfonyl-1-(3-methoxypropyl)-2,6-dimethylpiperazine.
| Compound Name | 4-ethylsulfonyl-1-(3-methoxypropyl)-2,6-dimethylpiperazine |
|---|---|
| PubChem CID | 110413041 |
| Molecular Formula | C12H26N2O3S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 4-ethylsulfonyl-1-(3-methoxypropyl)-2,6-dimethylpiperazine |
| SMILES | CCS(=O)(=O)N1CC(C)N(CCCOC)C(C)C1 |
| InChI | InChI=1S/C12H26N2O3S/c1-5-18(15,16)13-9-11(2)14(12(3)10-13)7-6-8-17-4/h11-12H,5-10H2,1-4H3 |
| InChIKey | BAQLHCVBEKLMKM-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|